C31H32N8O3S2Y2-2 — CID 58497291
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4-[2-oxo-2-[4-[5-(2,4,6-trimethylbenzene-3,5-diid-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]ethyl]benzenesulfonamide;bis(yttrium) (PubChem CID 58497291) has the molecular formula C31H32N8O3S2Y2-2 and a molecular weight of 806.60 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4-[2-oxo-2-[4-[5-(2,4,6-trimethylbenzene-3,5-diid-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]ethyl]benzenesulfonamide;bis(yttrium).
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4-[2-oxo-2-[4-[5-(2,4,6-trimethylbenzene-3,5-diid-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]ethyl]benzenesulfonamide;bis(yttrium) |
|---|---|
| PubChem CID | 58497291 |
| Molecular Formula | C31H32N8O3S2Y2-2 |
| Molecular Weight | 806.60 g/mol |
| Exact Mass | 806.02 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4-[2-oxo-2-[4-[5-(2,4,6-trimethylbenzene-3,5-diid-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]ethyl]benzenesulfonamide;bis(yttrium) |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(CC(=O)N3CCN(c4ncnc5[nH]cc(-c6c(C)[c-]c(C)[c-]c6C)c45)CC3)cc2)s1.[Y].[Y] |
| InChI | InChI=1S/C31H32N8O3S2.2Y/c1-5-25-35-36-31(43-25)37-44(41,42)23-8-6-22(7-9-23)16-26(40)38-10-12-39(13-11-38)30-28-24(17-32-29(28)33-18-34-30)27-20(3)14-19(2)15-21(27)4;;/h6-9,17-18H,5,10-13,16H2,1-4H3,(H,36,37)(H,32,33,34);;/q-2;; |
| InChIKey | FWRJUOWZOIUBRD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|