C5H14N2O — CID 58497355
N,N-dimethyl-2-(methylaminooxy)ethanamine (PubChem CID 58497355) has the molecular formula C5H14N2O and a molecular weight of 118.18 g/mol. Its IUPAC name is N,N-dimethyl-2-(methylaminooxy)ethanamine.
| Compound Name | N,N-dimethyl-2-(methylaminooxy)ethanamine |
|---|---|
| PubChem CID | 58497355 |
| Molecular Formula | C5H14N2O |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.11 |
| IUPAC Name | N,N-dimethyl-2-(methylaminooxy)ethanamine |
| SMILES | CNOCCN(C)C |
| InChI | InChI=1S/C5H14N2O/c1-6-8-5-4-7(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | NFHOHTXGZXYZEU-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|