About 1-ethyl-N,5-dimethylpyrazole-3-carboxamide
1-ethyl-N,5-dimethylpyrazole-3-carboxamide (PubChem CID 58497357) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-ethyl-N,5-dimethylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-N,5-dimethylpyrazole-3-carboxamide |
| PubChem CID | 58497357 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-ethyl-N,5-dimethylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C(=O)NC)cc1C |
| InChI | InChI=1S/C8H13N3O/c1-4-11-6(2)5-7(10-11)8(12)9-3/h5H,4H2,1-3H3,(H,9,12) |
| InChIKey | GEFLZMWCPJFMHW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-N,5-dimethylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N,5-dimethylpyrazole-3-carboxamide?
The IUPAC name of 1-ethyl-N,5-dimethylpyrazole-3-carboxamide (CID 58497357) is 1-ethyl-N,5-dimethylpyrazole-3-carboxamide.
What is the SMILES notation for 1-ethyl-N,5-dimethylpyrazole-3-carboxamide?
The canonical SMILES for 1-ethyl-N,5-dimethylpyrazole-3-carboxamide is CCn1nc(C(=O)NC)cc1C.
What is the InChIKey of 1-ethyl-N,5-dimethylpyrazole-3-carboxamide?
The InChIKey is GEFLZMWCPJFMHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-4-11-6(2)5-7(10-11)8(12)9-3/h5H,4H2,1-3H3,(H,9,12).
What are the key properties of 1-ethyl-N,5-dimethylpyrazole-3-carboxamide?
1-ethyl-N,5-dimethylpyrazole-3-carboxamide has a molecular weight of 167.21 g/mol, XLogP of 0.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N,5-dimethylpyrazole-3-carboxamide is sourced from PubChem (CID 58497357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).