C27H40N2O3 — CID 58497677
4-[(1S,9S)-5-tert-butyl-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]cyclohexane-1-carboxamide (PubChem CID 58497677) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is 4-[(1S,9S)-5-tert-butyl-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]cyclohexane-1-carboxamide.
| Compound Name | 4-[(1S,9S)-5-tert-butyl-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 58497677 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | 4-[(1S,9S)-5-tert-butyl-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc2c(c1O)C[C@@H]1N(C(=O)C3CCC(C(N)=O)CC3)CC[C@]2(C)C1(C)C |
| InChI | InChI=1S/C27H40N2O3/c1-25(2,3)20-12-11-19-18(22(20)30)15-21-26(4,5)27(19,6)13-14-29(21)24(32)17-9-7-16(8-10-17)23(28)31/h11-12,16-17,21,30H,7-10,13-15H2,1-6H3,(H2,28,31)/t16?,17?,21-,27-/m0/s1 |
| InChIKey | YLWURBSKLKOQFW-REEVKPFDSA-N |
| XLogP | 4.42 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |