C26H35NO3 — CID 58497751
(3-hydroxy-1-adamantyl)-[(1S,9S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone (PubChem CID 58497751) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl)-[(1S,9S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone.
| Compound Name | (3-hydroxy-1-adamantyl)-[(1S,9S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone |
|---|---|
| PubChem CID | 58497751 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | (3-hydroxy-1-adamantyl)-[(1S,9S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone |
| SMILES | CC1(C)[C@@H]2Cc3c(O)cccc3[C@]1(C)CCN2C(=O)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C26H35NO3/c1-23(2)21-10-18-19(5-4-6-20(18)28)24(23,3)7-8-27(21)22(29)25-11-16-9-17(12-25)14-26(30,13-16)15-25/h4-6,16-17,21,28,30H,7-15H2,1-3H3/t16?,17?,21-,24-,25?,26?/m0/s1 |
| InChIKey | GDRAEFIYNHDTBL-DRKCYHAOSA-N |
| XLogP | 4.16 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |