C27H46N2O3 — CID 58498188
[3-(dimethylamino)-2-[[(5Z,8Z)-undeca-5,8-dienoyl]amino]propyl] (5Z,8Z)-undeca-5,8-dienoate (PubChem CID 58498188) has the molecular formula C27H46N2O3 and a molecular weight of 446.68 g/mol. Its IUPAC name is [3-(dimethylamino)-2-[[(5Z,8Z)-undeca-5,8-dienoyl]amino]propyl] (5Z,8Z)-undeca-5,8-dienoate.
| Compound Name | [3-(dimethylamino)-2-[[(5Z,8Z)-undeca-5,8-dienoyl]amino]propyl] (5Z,8Z)-undeca-5,8-dienoate |
|---|---|
| PubChem CID | 58498188 |
| Molecular Formula | C27H46N2O3 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.35 |
| IUPAC Name | [3-(dimethylamino)-2-[[(5Z,8Z)-undeca-5,8-dienoyl]amino]propyl] (5Z,8Z)-undeca-5,8-dienoate |
| SMILES | CC/C=C\C/C=C\CCCC(=O)NC(COC(=O)CCC/C=C\C/C=C\CC)CN(C)C |
| InChI | InChI=1S/C27H46N2O3/c1-5-7-9-11-13-15-17-19-21-26(30)28-25(23-29(3)4)24-32-27(31)22-20-18-16-14-12-10-8-6-2/h7-10,13-16,25H,5-6,11-12,17-24H2,1-4H3,(H,28,30)/b9-7-,10-8-,15-13-,16-14- |
| InChIKey | NBWGQTJYJQZKDS-ALZJNQEASA-N |
| XLogP | 5.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|