C36H26F6N2O6 — CID 58498417
2-methyl-5-[1,1,1-trifluoro-2-[2-[2-hydroxy-5-[1,1,1-trifluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]isoindole-1,3-dione (PubChem CID 58498417) has the molecular formula C36H26F6N2O6 and a molecular weight of 696.60 g/mol. Its IUPAC name is 2-methyl-5-[1,1,1-trifluoro-2-[2-[2-hydroxy-5-[1,1,1-trifluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-methyl-5-[1,1,1-trifluoro-2-[2-[2-hydroxy-5-[1,1,1-trifluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58498417 |
| Molecular Formula | C36H26F6N2O6 |
| Molecular Weight | 696.60 g/mol |
| Exact Mass | 696.17 |
| IUPAC Name | 2-methyl-5-[1,1,1-trifluoro-2-[2-[2-hydroxy-5-[1,1,1-trifluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]isoindole-1,3-dione |
| SMILES | Cc1cc(C(C)(c2ccc(O)c(N3C(=O)c4ccc(C(C)(c5ccc6c(c5)C(=O)N(C)C6=O)C(F)(F)F)cc4C3=O)c2)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C36H26F6N2O6/c1-17-13-18(7-11-27(17)45)33(2,35(37,38)39)21-8-12-28(46)26(16-21)44-31(49)23-10-6-20(15-25(23)32(44)50)34(3,36(40,41)42)19-5-9-22-24(14-19)30(48)43(4)29(22)47/h5-16,45-46H,1-4H3 |
| InChIKey | PJGFXLZEBLCMRX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.60 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|