C21H27F5O4 — CID 58498492
(2,3,4,5,6-pentafluorophenyl) [2,3,3-trimethyl-2-(2-methylbutan-2-yl)-5-oxohexyl] carbonate (PubChem CID 58498492) has the molecular formula C21H27F5O4 and a molecular weight of 438.43 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) [2,3,3-trimethyl-2-(2-methylbutan-2-yl)-5-oxohexyl] carbonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) [2,3,3-trimethyl-2-(2-methylbutan-2-yl)-5-oxohexyl] carbonate |
|---|---|
| PubChem CID | 58498492 |
| Molecular Formula | C21H27F5O4 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) [2,3,3-trimethyl-2-(2-methylbutan-2-yl)-5-oxohexyl] carbonate |
| SMILES | CCC(C)(C)C(C)(COC(=O)Oc1c(F)c(F)c(F)c(F)c1F)C(C)(C)CC(C)=O |
| InChI | InChI=1S/C21H27F5O4/c1-8-19(3,4)21(7,20(5,6)9-11(2)27)10-29-18(28)30-17-15(25)13(23)12(22)14(24)16(17)26/h8-10H2,1-7H3 |
| InChIKey | DTJFNPBWTAIEHA-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|