C11H18O5 — CID 58498767
4-methoxy-2-[(2S,4S)-2-methyloxan-4-yl]-4-oxobutanoic acid (PubChem CID 58498767) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 4-methoxy-2-[(2S,4S)-2-methyloxan-4-yl]-4-oxobutanoic acid.
| Compound Name | 4-methoxy-2-[(2S,4S)-2-methyloxan-4-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58498767 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 4-methoxy-2-[(2S,4S)-2-methyloxan-4-yl]-4-oxobutanoic acid |
| SMILES | COC(=O)CC(C(=O)O)[C@H]1CCO[C@@H](C)C1 |
| InChI | InChI=1S/C11H18O5/c1-7-5-8(3-4-16-7)9(11(13)14)6-10(12)15-2/h7-9H,3-6H2,1-2H3,(H,13,14)/t7-,8-,9?/m0/s1 |
| InChIKey | PGVXUNULNNDNHT-JVIMKECRSA-N |
| XLogP | 1.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |