About 2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane
2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane (PubChem CID 58498889) has the molecular formula C13H19N3Si
and a molecular weight of 245.40 g/mol. Its IUPAC name is 2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane |
| PubChem CID | 58498889 |
| Molecular Formula | C13H19N3Si |
| Molecular Weight | 245.40 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1cnc(C2C[C@H]3C[C@H]3N2)[nH]1 |
| InChI | InChI=1S/C13H19N3Si/c1-17(2,3)5-4-10-8-14-13(15-10)12-7-9-6-11(9)16-12/h8-9,11-12,16H,6-7H2,1-3H3,(H,14,15)/t9-,11-,12?/m1/s1 |
| InChIKey | BOWAKDWCKRPNSU-DFWSTUSTSA-N |
| XLogP | 2.06 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane?
The IUPAC name of 2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane (CID 58498889) is 2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane.
What is the SMILES notation for 2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane?
The canonical SMILES for 2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane is C[Si](C)(C)C#Cc1cnc(C2C[C@H]3C[C@H]3N2)[nH]1.
What is the InChIKey of 2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane?
The InChIKey is BOWAKDWCKRPNSU-DFWSTUSTSA-N. The full InChI is InChI=1S/C13H19N3Si/c1-17(2,3)5-4-10-8-14-13(15-10)12-7-9-6-11(9)16-12/h8-9,11-12,16H,6-7H2,1-3H3,(H,14,15)/t9-,11-,12?/m1/s1.
What are the key properties of 2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane?
2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane has a molecular weight of 245.40 g/mol, XLogP of 2.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(1R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-1H-imidazol-5-yl]ethynyl-trimethylsilane is sourced from PubChem (CID 58498889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).