About 3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole
3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole (PubChem CID 58499138) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole |
| PubChem CID | 58499138 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole |
| SMILES | CC(C)C1=CC(C(C)C)CN1 |
| InChI | InChI=1S/C10H19N/c1-7(2)9-5-10(8(3)4)11-6-9/h5,7-9,11H,6H2,1-4H3 |
| InChIKey | IWWUJWKJOKEFRM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole?
The IUPAC name of 3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole (CID 58499138) is 3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole.
What is the SMILES notation for 3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole?
The canonical SMILES for 3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole is CC(C)C1=CC(C(C)C)CN1.
What is the InChIKey of 3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole?
The InChIKey is IWWUJWKJOKEFRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-7(2)9-5-10(8(3)4)11-6-9/h5,7-9,11H,6H2,1-4H3.
What are the key properties of 3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole?
3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole has a molecular weight of 153.27 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-di(propan-2-yl)-2,3-dihydro-1H-pyrrole is sourced from PubChem (CID 58499138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).