C21H30 — CID 58500279
1,2,3,4,5,6,8-heptamethyl-7-(2-methyl-2-tritiopropyl)naphthalene (PubChem CID 58500279) has the molecular formula C21H30 and a molecular weight of 284.48 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptamethyl-7-(2-methyl-2-tritiopropyl)naphthalene.
| Compound Name | 1,2,3,4,5,6,8-heptamethyl-7-(2-methyl-2-tritiopropyl)naphthalene |
|---|---|
| PubChem CID | 58500279 |
| Molecular Formula | C21H30 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 1,2,3,4,5,6,8-heptamethyl-7-(2-methyl-2-tritiopropyl)naphthalene |
| SMILES | [3H]C(C)(C)Cc1c(C)c(C)c2c(C)c(C)c(C)c(C)c2c1C |
| InChI | InChI=1S/C21H30/c1-11(2)10-19-14(5)17(8)20-15(6)12(3)13(4)16(7)21(20)18(19)9/h11H,10H2,1-9H3/i11T |
| InChIKey | CCIGHDPIDXVRFS-KNWSOFMKSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |