C61H63F3N2S2 — CID 58500504
7-methyl-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-diphenyl-6-(trifluoromethyl)quinoxaline (PubChem CID 58500504) has the molecular formula C61H63F3N2S2 and a molecular weight of 945.32 g/mol. Its IUPAC name is 7-methyl-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-diphenyl-6-(trifluoromethyl)quinoxaline.
| Compound Name | 7-methyl-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-diphenyl-6-(trifluoromethyl)quinoxaline |
|---|---|
| PubChem CID | 58500504 |
| Molecular Formula | C61H63F3N2S2 |
| Molecular Weight | 945.32 g/mol |
| Exact Mass | 944.44 |
| IUPAC Name | 7-methyl-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-diphenyl-6-(trifluoromethyl)quinoxaline |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc(-c4c(C(F)(F)F)c(C)c(-c5ccc(C)s5)c5nc(-c6ccccc6)c(-c6ccccc6)nc45)s3)cc21 |
| InChI | InChI=1S/C61H63F3N2S2/c1-6-8-10-12-14-22-36-60(37-23-15-13-11-9-7-2)48-38-40(3)28-31-46(48)47-32-30-45(39-49(47)60)50-34-35-52(68-50)54-55(61(62,63)64)42(5)53(51-33-29-41(4)67-51)58-59(54)66-57(44-26-20-17-21-27-44)56(65-58)43-24-18-16-19-25-43/h16-21,24-35,38-39H,6-15,22-23,36-37H2,1-5H3 |
| InChIKey | PJFSHDJTJPEIHM-UHFFFAOYSA-N |
| XLogP | 19.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.32 |
| LogP ≤ 5 | 19.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|