C59H62N2O2S2 — CID 58500559
5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)-4-methylthiophen-2-yl]-8-(4,5-dimethylthiophen-2-yl)-2,3-bis(4-methoxyphenyl)quinoxaline (PubChem CID 58500559) has the molecular formula C59H62N2O2S2 and a molecular weight of 895.29 g/mol. Its IUPAC name is 5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)-4-methylthiophen-2-yl]-8-(4,5-dimethylthiophen-2-yl)-2,3-bis(4-methoxyphenyl)quinoxaline.
| Compound Name | 5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)-4-methylthiophen-2-yl]-8-(4,5-dimethylthiophen-2-yl)-2,3-bis(4-methoxyphenyl)quinoxaline |
|---|---|
| PubChem CID | 58500559 |
| Molecular Formula | C59H62N2O2S2 |
| Molecular Weight | 895.29 g/mol |
| Exact Mass | 894.43 |
| IUPAC Name | 5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)-4-methylthiophen-2-yl]-8-(4,5-dimethylthiophen-2-yl)-2,3-bis(4-methoxyphenyl)quinoxaline |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C)ccc2-c2ccc(-c3sc(-c4ccc(-c5cc(C)c(C)s5)c5nc(-c6ccc(OC)cc6)c(-c6ccc(OC)cc6)nc45)cc3C)cc21 |
| InChI | InChI=1S/C59H62N2O2S2/c1-9-11-13-15-31-59(32-16-14-12-10-2)50-33-37(3)17-27-46(50)47-28-22-43(36-51(47)59)58-39(5)35-53(65-58)49-30-29-48(52-34-38(4)40(6)64-52)56-57(49)61-55(42-20-25-45(63-8)26-21-42)54(60-56)41-18-23-44(62-7)24-19-41/h17-30,33-36H,9-16,31-32H2,1-8H3 |
| InChIKey | PULLRNMMNUIXNV-UHFFFAOYSA-N |
| XLogP | 17.55 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.29 |
| LogP ≤ 5 | 17.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|