C57H56F2N2S2 — CID 58500567
5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)-4-methylthiophen-2-yl]-8-(4,5-dimethylthiophen-2-yl)-2,3-bis(4-fluorophenyl)quinoxaline (PubChem CID 58500567) has the molecular formula C57H56F2N2S2 and a molecular weight of 871.22 g/mol. Its IUPAC name is 5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)-4-methylthiophen-2-yl]-8-(4,5-dimethylthiophen-2-yl)-2,3-bis(4-fluorophenyl)quinoxaline.
| Compound Name | 5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)-4-methylthiophen-2-yl]-8-(4,5-dimethylthiophen-2-yl)-2,3-bis(4-fluorophenyl)quinoxaline |
|---|---|
| PubChem CID | 58500567 |
| Molecular Formula | C57H56F2N2S2 |
| Molecular Weight | 871.22 g/mol |
| Exact Mass | 870.39 |
| IUPAC Name | 5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)-4-methylthiophen-2-yl]-8-(4,5-dimethylthiophen-2-yl)-2,3-bis(4-fluorophenyl)quinoxaline |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C)ccc2-c2ccc(-c3sc(-c4ccc(-c5cc(C)c(C)s5)c5nc(-c6ccc(F)cc6)c(-c6ccc(F)cc6)nc45)cc3C)cc21 |
| InChI | InChI=1S/C57H56F2N2S2/c1-7-9-11-13-29-57(30-14-12-10-8-2)48-31-35(3)15-25-44(48)45-26-20-41(34-49(45)57)56-37(5)33-51(63-56)47-28-27-46(50-32-36(4)38(6)62-50)54-55(47)61-53(40-18-23-43(59)24-19-40)52(60-54)39-16-21-42(58)22-17-39/h15-28,31-34H,7-14,29-30H2,1-6H3 |
| InChIKey | ZTUXERGFLPUZAN-UHFFFAOYSA-N |
| XLogP | 17.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.22 |
| LogP ≤ 5 | 17.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|