C57H60N4S2 — CID 58500577
5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-dipyridin-4-ylquinoxaline (PubChem CID 58500577) has the molecular formula C57H60N4S2 and a molecular weight of 865.27 g/mol. Its IUPAC name is 5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-dipyridin-4-ylquinoxaline.
| Compound Name | 5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-dipyridin-4-ylquinoxaline |
|---|---|
| PubChem CID | 58500577 |
| Molecular Formula | C57H60N4S2 |
| Molecular Weight | 865.27 g/mol |
| Exact Mass | 864.43 |
| IUPAC Name | 5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-dipyridin-4-ylquinoxaline |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc(-c4ccc(-c5ccc(C)s5)c5nc(-c6ccncc6)c(-c6ccncc6)nc45)s3)cc21 |
| InChI | InChI=1S/C57H60N4S2/c1-5-7-9-11-13-15-31-57(32-16-14-12-10-8-6-2)48-37-39(3)17-20-44(48)45-21-19-43(38-49(45)57)50-25-26-52(63-50)47-23-22-46(51-24-18-40(4)62-51)55-56(47)61-54(42-29-35-59-36-30-42)53(60-55)41-27-33-58-34-28-41/h17-30,33-38H,5-16,31-32H2,1-4H3 |
| InChIKey | NIAJGQYAIJJOBY-UHFFFAOYSA-N |
| XLogP | 17.26 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.27 |
| LogP ≤ 5 | 17.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|