C58H60F2N2S2Si — CID 58500593
5-[5-[5,5-bis(2-ethylhexyl)-7-methylbenzo[b][1]benzosilol-3-yl]thiophen-2-yl]-2,3-bis(4-fluorophenyl)-8-(5-methylthiophen-2-yl)quinoxaline (PubChem CID 58500593) has the molecular formula C58H60F2N2S2Si and a molecular weight of 915.35 g/mol. Its IUPAC name is 5-[5-[5,5-bis(2-ethylhexyl)-7-methylbenzo[b][1]benzosilol-3-yl]thiophen-2-yl]-2,3-bis(4-fluorophenyl)-8-(5-methylthiophen-2-yl)quinoxaline.
| Compound Name | 5-[5-[5,5-bis(2-ethylhexyl)-7-methylbenzo[b][1]benzosilol-3-yl]thiophen-2-yl]-2,3-bis(4-fluorophenyl)-8-(5-methylthiophen-2-yl)quinoxaline |
|---|---|
| PubChem CID | 58500593 |
| Molecular Formula | C58H60F2N2S2Si |
| Molecular Weight | 915.35 g/mol |
| Exact Mass | 914.39 |
| IUPAC Name | 5-[5-[5,5-bis(2-ethylhexyl)-7-methylbenzo[b][1]benzosilol-3-yl]thiophen-2-yl]-2,3-bis(4-fluorophenyl)-8-(5-methylthiophen-2-yl)quinoxaline |
| SMILES | CCCCC(CC)C[Si]1(CC(CC)CCCC)c2cc(C)ccc2-c2ccc(-c3ccc(-c4ccc(-c5ccc(C)s5)c5nc(-c6ccc(F)cc6)c(-c6ccc(F)cc6)nc45)s3)cc21 |
| InChI | InChI=1S/C58H60F2N2S2Si/c1-7-11-13-39(9-3)35-65(36-40(10-4)14-12-8-2)53-33-37(5)15-26-46(53)47-27-21-43(34-54(47)65)50-31-32-52(64-50)49-29-28-48(51-30-16-38(6)63-51)57-58(49)62-56(42-19-24-45(60)25-20-42)55(61-57)41-17-22-44(59)23-18-41/h15-34,39-40H,7-14,35-36H2,1-6H3 |
| InChIKey | UYMTUFMEWYKPDW-UHFFFAOYSA-N |
| XLogP | 16.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.35 |
| LogP ≤ 5 | 16.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|