C55H52F2N2S2 — CID 58500649
5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)thiophen-2-yl]-6,7-difluoro-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxaline (PubChem CID 58500649) has the molecular formula C55H52F2N2S2 and a molecular weight of 843.16 g/mol. Its IUPAC name is 5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)thiophen-2-yl]-6,7-difluoro-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxaline.
| Compound Name | 5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)thiophen-2-yl]-6,7-difluoro-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxaline |
|---|---|
| PubChem CID | 58500649 |
| Molecular Formula | C55H52F2N2S2 |
| Molecular Weight | 843.16 g/mol |
| Exact Mass | 842.35 |
| IUPAC Name | 5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)thiophen-2-yl]-6,7-difluoro-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxaline |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc(-c4c(F)c(F)c(-c5ccc(C)s5)c5nc(-c6ccccc6)c(-c6ccccc6)nc45)s3)cc21 |
| InChI | InChI=1S/C55H52F2N2S2/c1-5-7-9-17-31-55(32-18-10-8-6-2)42-33-35(3)23-26-40(42)41-27-25-39(34-43(41)55)44-29-30-46(61-44)48-50(57)49(56)47(45-28-24-36(4)60-45)53-54(48)59-52(38-21-15-12-16-22-38)51(58-53)37-19-13-11-14-20-37/h11-16,19-30,33-34H,5-10,17-18,31-32H2,1-4H3 |
| InChIKey | RXRPLMDQUVTECO-UHFFFAOYSA-N |
| XLogP | 17.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.16 |
| LogP ≤ 5 | 17.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|