C48H39F2N3S2 — CID 58500691
2-[5-[6,7-difluoro-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxalin-5-yl]thiophen-2-yl]-9-hexyl-7-methylcarbazole (PubChem CID 58500691) has the molecular formula C48H39F2N3S2 and a molecular weight of 759.99 g/mol. Its IUPAC name is 2-[5-[6,7-difluoro-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxalin-5-yl]thiophen-2-yl]-9-hexyl-7-methylcarbazole.
| Compound Name | 2-[5-[6,7-difluoro-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxalin-5-yl]thiophen-2-yl]-9-hexyl-7-methylcarbazole |
|---|---|
| PubChem CID | 58500691 |
| Molecular Formula | C48H39F2N3S2 |
| Molecular Weight | 759.99 g/mol |
| Exact Mass | 759.26 |
| IUPAC Name | 2-[5-[6,7-difluoro-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxalin-5-yl]thiophen-2-yl]-9-hexyl-7-methylcarbazole |
| SMILES | CCCCCCn1c2cc(C)ccc2c2ccc(-c3ccc(-c4c(F)c(F)c(-c5ccc(C)s5)c5nc(-c6ccccc6)c(-c6ccccc6)nc45)s3)cc21 |
| InChI | InChI=1S/C48H39F2N3S2/c1-4-5-6-13-26-53-36-27-29(2)18-21-34(36)35-22-20-33(28-37(35)53)38-24-25-40(55-38)42-44(50)43(49)41(39-23-19-30(3)54-39)47-48(42)52-46(32-16-11-8-12-17-32)45(51-47)31-14-9-7-10-15-31/h7-12,14-25,27-28H,4-6,13,26H2,1-3H3 |
| InChIKey | HFWBFBWQVZLUER-UHFFFAOYSA-N |
| XLogP | 14.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.99 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|