C18H14N2S2 — CID 58500697
2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline (PubChem CID 58500697) has the molecular formula C18H14N2S2 and a molecular weight of 322.46 g/mol. Its IUPAC name is 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline.
| Compound Name | 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline |
|---|---|
| PubChem CID | 58500697 |
| Molecular Formula | C18H14N2S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline |
| SMILES | Cc1nc2c(-c3cccs3)ccc(-c3cccs3)c2nc1C |
| InChI | InChI=1S/C18H14N2S2/c1-11-12(2)20-18-14(16-6-4-10-22-16)8-7-13(17(18)19-11)15-5-3-9-21-15/h3-10H,1-2H3 |
| InChIKey | WTOPNAPZQYZYIP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |