About 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline
2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline (PubChem CID 58500697) has the molecular formula C18H14N2S2
and a molecular weight of 322.46 g/mol. Its IUPAC name is 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline.
Molecular Properties
| Compound Name | 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline |
| PubChem CID | 58500697 |
| Molecular Formula | C18H14N2S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline |
| SMILES | Cc1nc2c(-c3cccs3)ccc(-c3cccs3)c2nc1C |
| InChI | InChI=1S/C18H14N2S2/c1-11-12(2)20-18-14(16-6-4-10-22-16)8-7-13(17(18)19-11)15-5-3-9-21-15/h3-10H,1-2H3 |
| InChIKey | WTOPNAPZQYZYIP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline?
The IUPAC name of 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline (CID 58500697) is 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline.
What is the SMILES notation for 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline?
The canonical SMILES for 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline is Cc1nc2c(-c3cccs3)ccc(-c3cccs3)c2nc1C.
What is the InChIKey of 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline?
The InChIKey is WTOPNAPZQYZYIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2S2/c1-11-12(2)20-18-14(16-6-4-10-22-16)8-7-13(17(18)19-11)15-5-3-9-21-15/h3-10H,1-2H3.
What are the key properties of 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline?
2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline has a molecular weight of 322.46 g/mol, XLogP of 5.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-5,8-dithiophen-2-ylquinoxaline is sourced from PubChem (CID 58500697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).