C28H28O8 — CID 58500776
3,6-bis[(4-methylphenyl)methoxycarbonyl]bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid (PubChem CID 58500776) has the molecular formula C28H28O8 and a molecular weight of 492.52 g/mol. Its IUPAC name is 3,6-bis[(4-methylphenyl)methoxycarbonyl]bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid.
| Compound Name | 3,6-bis[(4-methylphenyl)methoxycarbonyl]bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 58500776 |
| Molecular Formula | C28H28O8 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 3,6-bis[(4-methylphenyl)methoxycarbonyl]bicyclo[2.2.2]oct-7-ene-2,5-dicarboxylic acid |
| SMILES | Cc1ccc(COC(=O)C2C3C=CC(C2C(=O)O)C(C(=O)OCc2ccc(C)cc2)C3C(=O)O)cc1 |
| InChI | InChI=1S/C28H28O8/c1-15-3-7-17(8-4-15)13-35-27(33)23-19-11-12-20(21(23)25(29)30)24(22(19)26(31)32)28(34)36-14-18-9-5-16(2)6-10-18/h3-12,19-24H,13-14H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | HYLXWAJWJLPLIL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|