C23H23F2NO2 — CID 58501776
ethyl 2-(benzhydrylideneamino)-2-[(1R,5S)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]acetate (PubChem CID 58501776) has the molecular formula C23H23F2NO2 and a molecular weight of 383.44 g/mol. Its IUPAC name is ethyl 2-(benzhydrylideneamino)-2-[(1R,5S)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]acetate.
| Compound Name | ethyl 2-(benzhydrylideneamino)-2-[(1R,5S)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]acetate |
|---|---|
| PubChem CID | 58501776 |
| Molecular Formula | C23H23F2NO2 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | ethyl 2-(benzhydrylideneamino)-2-[(1R,5S)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]acetate |
| SMILES | CCOC(=O)C(N=C(c1ccccc1)c1ccccc1)C1C[C@@H]2[C@H](C1)C2(F)F |
| InChI | InChI=1S/C23H23F2NO2/c1-2-28-22(27)21(17-13-18-19(14-17)23(18,24)25)26-20(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17-19,21H,2,13-14H2,1H3/t17?,18-,19+,21? |
| InChIKey | NCNVFQYIYKPLDB-SGBLEOHJSA-N |
| XLogP | 4.75 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|