About 1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate
1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate (PubChem CID 58501782) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate |
| PubChem CID | 58501782 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate |
| SMILES | CCOC(=O)C(CC(=O)OC)C1C[C@@H]2C[C@@H]2C1 |
| InChI | InChI=1S/C13H20O4/c1-3-17-13(15)11(7-12(14)16-2)10-5-8-4-9(8)6-10/h8-11H,3-7H2,1-2H3/t8-,9+,10?,11? |
| InChIKey | QWDYEKJEWHEKOB-IXBNRNDTSA-N |
| XLogP | 1.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate?
The IUPAC name of 1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate (CID 58501782) is 1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate.
What is the SMILES notation for 1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate?
The canonical SMILES for 1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate is CCOC(=O)C(CC(=O)OC)C1C[C@@H]2C[C@@H]2C1.
What is the InChIKey of 1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate?
The InChIKey is QWDYEKJEWHEKOB-IXBNRNDTSA-N. The full InChI is InChI=1S/C13H20O4/c1-3-17-13(15)11(7-12(14)16-2)10-5-8-4-9(8)6-10/h8-11H,3-7H2,1-2H3/t8-,9+,10?,11?.
What are the key properties of 1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate?
1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate has a molecular weight of 240.30 g/mol, XLogP of 1.77, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 4-O-methyl 2-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]butanedioate is sourced from PubChem (CID 58501782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).