C19H19Cl2N5O3 — CID 58502092
N-cyclohexyl-4-(2,6-dichlorophenyl)-N-(furan-2-ylmethyl)-5-oxotetrazole-1-carboxamide (PubChem CID 58502092) has the molecular formula C19H19Cl2N5O3 and a molecular weight of 436.30 g/mol. Its IUPAC name is N-cyclohexyl-4-(2,6-dichlorophenyl)-N-(furan-2-ylmethyl)-5-oxotetrazole-1-carboxamide.
| Compound Name | N-cyclohexyl-4-(2,6-dichlorophenyl)-N-(furan-2-ylmethyl)-5-oxotetrazole-1-carboxamide |
|---|---|
| PubChem CID | 58502092 |
| Molecular Formula | C19H19Cl2N5O3 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-cyclohexyl-4-(2,6-dichlorophenyl)-N-(furan-2-ylmethyl)-5-oxotetrazole-1-carboxamide |
| SMILES | O=C(N(Cc1ccco1)C1CCCCC1)n1nnn(-c2c(Cl)cccc2Cl)c1=O |
| InChI | InChI=1S/C19H19Cl2N5O3/c20-15-9-4-10-16(21)17(15)25-19(28)26(23-22-25)18(27)24(12-14-8-5-11-29-14)13-6-2-1-3-7-13/h4-5,8-11,13H,1-3,6-7,12H2 |
| InChIKey | CJEMEDPWNXPLPK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 86.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|