About benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate
benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate (PubChem CID 58502465) has the molecular formula C25H20ClF2N5O4
and a molecular weight of 527.92 g/mol. Its IUPAC name is benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate.
Molecular Properties
| Compound Name | benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate |
| PubChem CID | 58502465 |
| Molecular Formula | C25H20ClF2N5O4 |
| Molecular Weight | 527.92 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate |
| SMILES | CC(C)N(C(=O)n1nnn(-c2c(F)cccc2F)c1=O)c1ccc(Cl)c(C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H20ClF2N5O4/c1-15(2)31(24(35)33-25(36)32(29-30-33)22-20(27)9-6-10-21(22)28)17-11-12-19(26)18(13-17)23(34)37-14-16-7-4-3-5-8-16/h3-13,15H,14H2,1-2H3 |
| InChIKey | FVTIXNNQMLRXFS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 527.92 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate?
The IUPAC name of benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate (CID 58502465) is benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate.
What is the SMILES notation for benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate?
The canonical SMILES for benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate is CC(C)N(C(=O)n1nnn(-c2c(F)cccc2F)c1=O)c1ccc(Cl)c(C(=O)OCc2ccccc2)c1.
What is the InChIKey of benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate?
The InChIKey is FVTIXNNQMLRXFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20ClF2N5O4/c1-15(2)31(24(35)33-25(36)32(29-30-33)22-20(27)9-6-10-21(22)28)17-11-12-19(26)18(13-17)23(34)37-14-16-7-4-3-5-8-16/h3-13,15H,14H2,1-2H3.
What are the key properties of benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate?
benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate has a molecular weight of 527.92 g/mol, XLogP of 4.60, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-chloro-5-[[4-(2,6-difluorophenyl)-5-oxotetrazole-1-carbonyl]-propan-2-ylamino]benzoate is sourced from PubChem (CID 58502465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).