About 3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid
3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid (PubChem CID 58502487) has the molecular formula C17H13Cl2N5O4
and a molecular weight of 422.23 g/mol. Its IUPAC name is 3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid.
Molecular Properties
| Compound Name | 3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid |
| PubChem CID | 58502487 |
| Molecular Formula | C17H13Cl2N5O4 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid |
| SMILES | CCN(C(=O)n1nnn(-c2c(Cl)cccc2Cl)c1=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H13Cl2N5O4/c1-2-22(11-6-3-5-10(9-11)15(25)26)16(27)24-17(28)23(20-21-24)14-12(18)7-4-8-13(14)19/h3-9H,2H2,1H3,(H,25,26) |
| InChIKey | ZGWIJECZKGVQHB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid?
The IUPAC name of 3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid (CID 58502487) is 3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid.
What is the SMILES notation for 3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid?
The canonical SMILES for 3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid is CCN(C(=O)n1nnn(-c2c(Cl)cccc2Cl)c1=O)c1cccc(C(=O)O)c1.
What is the InChIKey of 3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid?
The InChIKey is ZGWIJECZKGVQHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl2N5O4/c1-2-22(11-6-3-5-10(9-11)15(25)26)16(27)24-17(28)23(20-21-24)14-12(18)7-4-8-13(14)19/h3-9H,2H2,1H3,(H,25,26).
What are the key properties of 3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid?
3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid has a molecular weight of 422.23 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]benzoic acid is sourced from PubChem (CID 58502487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).