About (2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol
(2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol (PubChem CID 58502500) has the molecular formula C6H12O4
and a molecular weight of 148.16 g/mol. Its IUPAC name is (2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol.
Molecular Properties
| Compound Name | (2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol |
| PubChem CID | 58502500 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | (2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol |
| SMILES | C[C@@H]1OCC(O)(CO)[C@@H]1O |
| InChI | InChI=1S/C6H12O4/c1-4-5(8)6(9,2-7)3-10-4/h4-5,7-9H,2-3H2,1H3/t4-,5+,6?/m0/s1 |
| InChIKey | KBBDENCHHNISJT-YRZWDFBDSA-N |
| XLogP | -1.51 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol?
The IUPAC name of (2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol (CID 58502500) is (2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol.
What is the SMILES notation for (2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol?
The canonical SMILES for (2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol is C[C@@H]1OCC(O)(CO)[C@@H]1O.
What is the InChIKey of (2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol?
The InChIKey is KBBDENCHHNISJT-YRZWDFBDSA-N. The full InChI is InChI=1S/C6H12O4/c1-4-5(8)6(9,2-7)3-10-4/h4-5,7-9H,2-3H2,1H3/t4-,5+,6?/m0/s1.
What are the key properties of (2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol?
(2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol has a molecular weight of 148.16 g/mol, XLogP of -1.51, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-4-(hydroxymethyl)-2-methyloxolane-3,4-diol is sourced from PubChem (CID 58502500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).