About methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate
methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate (PubChem CID 58502518) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate |
| PubChem CID | 58502518 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate |
| SMILES | COC(=O)/C=C/Cc1c(C)cc(/C(N)=N/O)cc1C |
| InChI | InChI=1S/C14H18N2O3/c1-9-7-11(14(15)16-18)8-10(2)12(9)5-4-6-13(17)19-3/h4,6-8,18H,5H2,1-3H3,(H2,15,16)/b6-4+ |
| InChIKey | RKSWHGBQFDFXRA-GQCTYLIASA-N |
| XLogP | 1.67 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate?
The IUPAC name of methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate (CID 58502518) is methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate.
What is the SMILES notation for methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate?
The canonical SMILES for methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate is COC(=O)/C=C/Cc1c(C)cc(/C(N)=N/O)cc1C.
What is the InChIKey of methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate?
The InChIKey is RKSWHGBQFDFXRA-GQCTYLIASA-N. The full InChI is InChI=1S/C14H18N2O3/c1-9-7-11(14(15)16-18)8-10(2)12(9)5-4-6-13(17)19-3/h4,6-8,18H,5H2,1-3H3,(H2,15,16)/b6-4+.
What are the key properties of methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate?
methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate has a molecular weight of 262.31 g/mol, XLogP of 1.67, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-[4-[(Z)-N'-hydroxycarbamimidoyl]-2,6-dimethylphenyl]but-2-enoate is sourced from PubChem (CID 58502518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).