C7H6O7 — CID 58502714
1,3,7-trioxecane-4,6,8,10-tetrone (PubChem CID 58502714) has the molecular formula C7H6O7 and a molecular weight of 202.12 g/mol. Its IUPAC name is 1,3,7-trioxecane-4,6,8,10-tetrone.
| Compound Name | 1,3,7-trioxecane-4,6,8,10-tetrone |
|---|---|
| PubChem CID | 58502714 |
| Molecular Formula | C7H6O7 |
| Molecular Weight | 202.12 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 1,3,7-trioxecane-4,6,8,10-tetrone |
| SMILES | O=C1CC(=O)OC(=O)CC(=O)OCO1 |
| InChI | InChI=1S/C7H6O7/c8-4-1-6(10)14-7(11)2-5(9)13-3-12-4/h1-3H2 |
| InChIKey | MUHRYTLBBDNAHA-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.12 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|