About 2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one
2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one (PubChem CID 58502805) has the molecular formula C19H15ClF2O2
and a molecular weight of 348.78 g/mol. Its IUPAC name is 2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one |
| PubChem CID | 58502805 |
| Molecular Formula | C19H15ClF2O2 |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one |
| SMILES | CCc1ccc(-c2ccc(Cl)c(F)c2F)cc1C1=C(O)CCC1=O |
| InChI | InChI=1S/C19H15ClF2O2/c1-2-10-3-4-11(12-5-6-14(20)19(22)18(12)21)9-13(10)17-15(23)7-8-16(17)24/h3-6,9,23H,2,7-8H2,1H3 |
| InChIKey | ZJMYUKXXYHJZBS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one?
The IUPAC name of 2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one (CID 58502805) is 2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one.
What is the SMILES notation for 2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one?
The canonical SMILES for 2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one is CCc1ccc(-c2ccc(Cl)c(F)c2F)cc1C1=C(O)CCC1=O.
What is the InChIKey of 2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one?
The InChIKey is ZJMYUKXXYHJZBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClF2O2/c1-2-10-3-4-11(12-5-6-14(20)19(22)18(12)21)9-13(10)17-15(23)7-8-16(17)24/h3-6,9,23H,2,7-8H2,1H3.
What are the key properties of 2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one?
2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one has a molecular weight of 348.78 g/mol, XLogP of 5.48, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-3-hydroxycyclopent-2-en-1-one is sourced from PubChem (CID 58502805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).