About [(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate
[(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate (PubChem CID 58503402) has the molecular formula C16H26O7
and a molecular weight of 330.38 g/mol. Its IUPAC name is [(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate.
Molecular Properties
| Compound Name | [(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate |
| PubChem CID | 58503402 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | [(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate |
| SMILES | CCCCO[C@H]1[C@@H](CCC(C)=O)OC(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H26O7/c1-5-6-9-20-14-13(8-7-10(2)17)23-16(22-12(4)19)15(14)21-11(3)18/h13-16H,5-9H2,1-4H3/t13-,14+,15-,16?/m1/s1 |
| InChIKey | QHFIXQSRPGUXKF-IUOOZAAYSA-N |
| XLogP | 1.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate?
The IUPAC name of [(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate (CID 58503402) is [(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate.
What is the SMILES notation for [(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate?
The canonical SMILES for [(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate is CCCCO[C@H]1[C@@H](CCC(C)=O)OC(OC(C)=O)[C@@H]1OC(C)=O.
What is the InChIKey of [(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate?
The InChIKey is QHFIXQSRPGUXKF-IUOOZAAYSA-N. The full InChI is InChI=1S/C16H26O7/c1-5-6-9-20-14-13(8-7-10(2)17)23-16(22-12(4)19)15(14)21-11(3)18/h13-16H,5-9H2,1-4H3/t13-,14+,15-,16?/m1/s1.
What are the key properties of [(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate?
[(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate has a molecular weight of 330.38 g/mol, XLogP of 1.76, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S,5R)-2-acetyloxy-4-butoxy-5-(3-oxobutyl)oxolan-3-yl] acetate is sourced from PubChem (CID 58503402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).