C18H26O9 — CID 58503414
[(3R,4S,5R)-2,4-diacetyloxy-4,5-bis(3-oxobutyl)oxolan-3-yl] acetate (PubChem CID 58503414) has the molecular formula C18H26O9 and a molecular weight of 386.40 g/mol. Its IUPAC name is [(3R,4S,5R)-2,4-diacetyloxy-4,5-bis(3-oxobutyl)oxolan-3-yl] acetate.
| Compound Name | [(3R,4S,5R)-2,4-diacetyloxy-4,5-bis(3-oxobutyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 58503414 |
| Molecular Formula | C18H26O9 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [(3R,4S,5R)-2,4-diacetyloxy-4,5-bis(3-oxobutyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)CC[C@H]1OC(OC(C)=O)[C@H](OC(C)=O)[C@@]1(CCC(C)=O)OC(C)=O |
| InChI | InChI=1S/C18H26O9/c1-10(19)6-7-15-18(27-14(5)23,9-8-11(2)20)16(24-12(3)21)17(26-15)25-13(4)22/h15-17H,6-9H2,1-5H3/t15-,16+,17?,18+/m1/s1 |
| InChIKey | AOXBPINDHHVLHS-BHGSFYIQSA-N |
| XLogP | 1.25 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|