About 2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid
2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid (PubChem CID 58503440) has the molecular formula C9H10FN3O5
and a molecular weight of 259.19 g/mol. Its IUPAC name is 2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid |
| PubChem CID | 58503440 |
| Molecular Formula | C9H10FN3O5 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)n1cc(F)c(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C9H10FN3O5/c10-4-3-13(9(18)12-7(4)15)6(14)2-1-5(11)8(16)17/h3,5H,1-2,11H2,(H,16,17)(H,12,15,18) |
| InChIKey | LRIKPDBKXCRPOC-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 135.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid?
The IUPAC name of 2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid (CID 58503440) is 2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid.
What is the SMILES notation for 2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid?
The canonical SMILES for 2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid is NC(CCC(=O)n1cc(F)c(=O)[nH]c1=O)C(=O)O.
What is the InChIKey of 2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid?
The InChIKey is LRIKPDBKXCRPOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN3O5/c10-4-3-13(9(18)12-7(4)15)6(14)2-1-5(11)8(16)17/h3,5H,1-2,11H2,(H,16,17)(H,12,15,18).
What are the key properties of 2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid?
2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid has a molecular weight of 259.19 g/mol, XLogP of -1.49, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-oxopentanoic acid is sourced from PubChem (CID 58503440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).