About methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate
methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate (PubChem CID 58503444) has the molecular formula C9H10FN3O5
and a molecular weight of 259.19 g/mol. Its IUPAC name is methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate.
Molecular Properties
| Compound Name | methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate |
| PubChem CID | 58503444 |
| Molecular Formula | C9H10FN3O5 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate |
| SMILES | COC(=O)C(N)CC(=O)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H10FN3O5/c1-18-8(16)5(11)2-6(14)13-3-4(10)7(15)12-9(13)17/h3,5H,2,11H2,1H3,(H,12,15,17) |
| InChIKey | DRVVCEVOFAMAOK-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 124.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate?
The IUPAC name of methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate (CID 58503444) is methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate.
What is the SMILES notation for methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate?
The canonical SMILES for methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate is COC(=O)C(N)CC(=O)n1cc(F)c(=O)[nH]c1=O.
What is the InChIKey of methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate?
The InChIKey is DRVVCEVOFAMAOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN3O5/c1-18-8(16)5(11)2-6(14)13-3-4(10)7(15)12-9(13)17/h3,5H,2,11H2,1H3,(H,12,15,17).
What are the key properties of methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate?
methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate has a molecular weight of 259.19 g/mol, XLogP of -1.79, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-oxobutanoate is sourced from PubChem (CID 58503444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).