C48H41F3MnN8+4 — CID 58503618
manganese(2+);5,10,15-tris(1-ethylpyridin-1-ium-3-yl)-20-[1-(2,2,2-trifluoroethyl)pyridin-1-ium-3-yl]porphyrin-22,24-diide (PubChem CID 58503618) has the molecular formula C48H41F3MnN8+4 and a molecular weight of 841.84 g/mol. Its IUPAC name is manganese(2+);5,10,15-tris(1-ethylpyridin-1-ium-3-yl)-20-[1-(2,2,2-trifluoroethyl)pyridin-1-ium-3-yl]porphyrin-22,24-diide.
| Compound Name | manganese(2+);5,10,15-tris(1-ethylpyridin-1-ium-3-yl)-20-[1-(2,2,2-trifluoroethyl)pyridin-1-ium-3-yl]porphyrin-22,24-diide |
|---|---|
| PubChem CID | 58503618 |
| Molecular Formula | C48H41F3MnN8+4 |
| Molecular Weight | 841.84 g/mol |
| Exact Mass | 841.28 |
| IUPAC Name | manganese(2+);5,10,15-tris(1-ethylpyridin-1-ium-3-yl)-20-[1-(2,2,2-trifluoroethyl)pyridin-1-ium-3-yl]porphyrin-22,24-diide |
| SMILES | CC[n+]1cccc(-c2c3nc(c(-c4ccc[n+](CC)c4)c4ccc([n-]4)c(-c4ccc[n+](CC(F)(F)F)c4)c4nc(c(-c5ccc[n+](CC)c5)c5ccc2[n-]5)C=C4)C=C3)c1.[Mn+2] |
| InChI | InChI=1S/C48H41F3N8.Mn/c1-4-56-23-7-11-32(27-56)44-36-15-17-38(52-36)45(33-12-8-24-57(5-2)28-33)40-19-21-42(54-40)47(35-14-10-26-59(30-35)31-48(49,50)51)43-22-20-41(55-43)46(39-18-16-37(44)53-39)34-13-9-25-58(6-3)29-34;/h7-30H,4-6,31H2,1-3H3;/q2*+2/b44-36-,44-37-,45-38-,45-40-,46-39-,46-41-,47-42-,47-43-; |
| InChIKey | DWDIUPPPIGFYBP-RUNSENEXSA-N |
| XLogP | 8.35 |
| TPSA | 69.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.84 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|