About 1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate
1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate (PubChem CID 58503722) has the molecular formula C15H12ClN5O2
and a molecular weight of 329.75 g/mol. Its IUPAC name is 1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate.
Molecular Properties
| Compound Name | 1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate |
| PubChem CID | 58503722 |
| Molecular Formula | C15H12ClN5O2 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate |
| SMILES | O=C(/C=C\n1cnc(-c2cccc(Cl)c2)n1)OCc1cnc[nH]1 |
| InChI | InChI=1S/C15H12ClN5O2/c16-12-3-1-2-11(6-12)15-19-10-21(20-15)5-4-14(22)23-8-13-7-17-9-18-13/h1-7,9-10H,8H2,(H,17,18)/b5-4- |
| InChIKey | UIVKPOQFKNJSFO-PLNGDYQASA-N |
| XLogP | 2.54 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate?
The IUPAC name of 1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate (CID 58503722) is 1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate.
What is the SMILES notation for 1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate?
The canonical SMILES for 1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate is O=C(/C=C\n1cnc(-c2cccc(Cl)c2)n1)OCc1cnc[nH]1.
What is the InChIKey of 1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate?
The InChIKey is UIVKPOQFKNJSFO-PLNGDYQASA-N. The full InChI is InChI=1S/C15H12ClN5O2/c16-12-3-1-2-11(6-12)15-19-10-21(20-15)5-4-14(22)23-8-13-7-17-9-18-13/h1-7,9-10H,8H2,(H,17,18)/b5-4-.
What are the key properties of 1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate?
1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate has a molecular weight of 329.75 g/mol, XLogP of 2.54, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazol-5-ylmethyl (Z)-3-[3-(3-chlorophenyl)-1,2,4-triazol-1-yl]prop-2-enoate is sourced from PubChem (CID 58503722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).