About 5-propan-2-yloxybenzene-1,3-dicarbonitrile
5-propan-2-yloxybenzene-1,3-dicarbonitrile (PubChem CID 58503738) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is 5-propan-2-yloxybenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-propan-2-yloxybenzene-1,3-dicarbonitrile |
| PubChem CID | 58503738 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 5-propan-2-yloxybenzene-1,3-dicarbonitrile |
| SMILES | CC(C)Oc1cc(C#N)cc(C#N)c1 |
| InChI | InChI=1S/C11H10N2O/c1-8(2)14-11-4-9(6-12)3-10(5-11)7-13/h3-5,8H,1-2H3 |
| InChIKey | MTIXIEOZCYHDCN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-propan-2-yloxybenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yloxybenzene-1,3-dicarbonitrile?
The IUPAC name of 5-propan-2-yloxybenzene-1,3-dicarbonitrile (CID 58503738) is 5-propan-2-yloxybenzene-1,3-dicarbonitrile.
What is the SMILES notation for 5-propan-2-yloxybenzene-1,3-dicarbonitrile?
The canonical SMILES for 5-propan-2-yloxybenzene-1,3-dicarbonitrile is CC(C)Oc1cc(C#N)cc(C#N)c1.
What is the InChIKey of 5-propan-2-yloxybenzene-1,3-dicarbonitrile?
The InChIKey is MTIXIEOZCYHDCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O/c1-8(2)14-11-4-9(6-12)3-10(5-11)7-13/h3-5,8H,1-2H3.
What are the key properties of 5-propan-2-yloxybenzene-1,3-dicarbonitrile?
5-propan-2-yloxybenzene-1,3-dicarbonitrile has a molecular weight of 186.21 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yloxybenzene-1,3-dicarbonitrile is sourced from PubChem (CID 58503738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).