About (E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one
(E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one (PubChem CID 58503750) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is (E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one.
Molecular Properties
| Compound Name | (E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one |
| PubChem CID | 58503750 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | (E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/n1cnc(C)n1 |
| InChI | InChI=1S/C7H9N3O/c1-6(11)3-4-10-5-8-7(2)9-10/h3-5H,1-2H3/b4-3+ |
| InChIKey | ITQNGMVFLOYUGD-ONEGZZNKSA-N |
| XLogP | 0.65 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one?
The IUPAC name of (E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one (CID 58503750) is (E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one.
What is the SMILES notation for (E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one?
The canonical SMILES for (E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one is CC(=O)/C=C/n1cnc(C)n1.
What is the InChIKey of (E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one?
The InChIKey is ITQNGMVFLOYUGD-ONEGZZNKSA-N. The full InChI is InChI=1S/C7H9N3O/c1-6(11)3-4-10-5-8-7(2)9-10/h3-5H,1-2H3/b4-3+.
What are the key properties of (E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one?
(E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one has a molecular weight of 151.17 g/mol, XLogP of 0.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(3-methyl-1,2,4-triazol-1-yl)but-3-en-2-one is sourced from PubChem (CID 58503750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).