About 2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde
2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 58503981) has the molecular formula C7H4N2OS2
and a molecular weight of 196.26 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde |
| PubChem CID | 58503981 |
| Molecular Formula | C7H4N2OS2 |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 195.98 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(-c2nccs2)s1 |
| InChI | InChI=1S/C7H4N2OS2/c10-4-5-3-9-7(12-5)6-8-1-2-11-6/h1-4H |
| InChIKey | BNILNMKHPLYZMK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde?
The IUPAC name of 2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde (CID 58503981) is 2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde.
What is the SMILES notation for 2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde?
The canonical SMILES for 2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde is O=Cc1cnc(-c2nccs2)s1.
What is the InChIKey of 2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde?
The InChIKey is BNILNMKHPLYZMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2OS2/c10-4-5-3-9-7(12-5)6-8-1-2-11-6/h1-4H.
What are the key properties of 2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde?
2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde has a molecular weight of 196.26 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-yl)-1,3-thiazole-5-carbaldehyde is sourced from PubChem (CID 58503981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).