About 2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde
2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde (PubChem CID 58504018) has the molecular formula C8H5N3OS
and a molecular weight of 191.22 g/mol. Its IUPAC name is 2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde |
| PubChem CID | 58504018 |
| Molecular Formula | C8H5N3OS |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | 2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(-c2ncccn2)s1 |
| InChI | InChI=1S/C8H5N3OS/c12-5-6-4-11-8(13-6)7-9-2-1-3-10-7/h1-5H |
| InChIKey | IAAJIHOUAWEYPY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde?
The IUPAC name of 2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde (CID 58504018) is 2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde.
What is the SMILES notation for 2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde?
The canonical SMILES for 2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde is O=Cc1cnc(-c2ncccn2)s1.
What is the InChIKey of 2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde?
The InChIKey is IAAJIHOUAWEYPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3OS/c12-5-6-4-11-8(13-6)7-9-2-1-3-10-7/h1-5H.
What are the key properties of 2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde?
2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde has a molecular weight of 191.22 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrimidin-2-yl-1,3-thiazole-5-carbaldehyde is sourced from PubChem (CID 58504018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).