C17H19ClN2O2 — CID 58504285
2-[1-[(3-phenyl-1,2-oxazol-5-yl)methyl]piperidin-4-yl]acetyl chloride (PubChem CID 58504285) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 2-[1-[(3-phenyl-1,2-oxazol-5-yl)methyl]piperidin-4-yl]acetyl chloride.
| Compound Name | 2-[1-[(3-phenyl-1,2-oxazol-5-yl)methyl]piperidin-4-yl]acetyl chloride |
|---|---|
| PubChem CID | 58504285 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-[1-[(3-phenyl-1,2-oxazol-5-yl)methyl]piperidin-4-yl]acetyl chloride |
| SMILES | O=C(Cl)CC1CCN(Cc2cc(-c3ccccc3)no2)CC1 |
| InChI | InChI=1S/C17H19ClN2O2/c18-17(21)10-13-6-8-20(9-7-13)12-15-11-16(19-22-15)14-4-2-1-3-5-14/h1-5,11,13H,6-10,12H2 |
| InChIKey | WIMOHVRMHSGMEK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|