C23H24N6O4 — CID 58504345
[(Z)-[amino-[4-[(3-methoxycarbonylazetidin-1-yl)methyl]phenyl]methylidene]amino] 5-amino-1-phenylpyrazole-4-carboxylate (PubChem CID 58504345) has the molecular formula C23H24N6O4 and a molecular weight of 448.48 g/mol. Its IUPAC name is [(Z)-[amino-[4-[(3-methoxycarbonylazetidin-1-yl)methyl]phenyl]methylidene]amino] 5-amino-1-phenylpyrazole-4-carboxylate.
| Compound Name | [(Z)-[amino-[4-[(3-methoxycarbonylazetidin-1-yl)methyl]phenyl]methylidene]amino] 5-amino-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 58504345 |
| Molecular Formula | C23H24N6O4 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | [(Z)-[amino-[4-[(3-methoxycarbonylazetidin-1-yl)methyl]phenyl]methylidene]amino] 5-amino-1-phenylpyrazole-4-carboxylate |
| SMILES | COC(=O)C1CN(Cc2ccc(/C(N)=N/OC(=O)c3cnn(-c4ccccc4)c3N)cc2)C1 |
| InChI | InChI=1S/C23H24N6O4/c1-32-22(30)17-13-28(14-17)12-15-7-9-16(10-8-15)20(24)27-33-23(31)19-11-26-29(21(19)25)18-5-3-2-4-6-18/h2-11,17H,12-14,25H2,1H3,(H2,24,27) |
| InChIKey | NBCVPFNJNOCOSX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 138.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|