C18H23N7O2 — CID 58504384
6-[2-amino-6-[(3R)-3-ethylmorpholin-4-yl]pyrimidin-4-yl]-4-methoxy-1H-indazol-3-amine (PubChem CID 58504384) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 6-[2-amino-6-[(3R)-3-ethylmorpholin-4-yl]pyrimidin-4-yl]-4-methoxy-1H-indazol-3-amine.
| Compound Name | 6-[2-amino-6-[(3R)-3-ethylmorpholin-4-yl]pyrimidin-4-yl]-4-methoxy-1H-indazol-3-amine |
|---|---|
| PubChem CID | 58504384 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 6-[2-amino-6-[(3R)-3-ethylmorpholin-4-yl]pyrimidin-4-yl]-4-methoxy-1H-indazol-3-amine |
| SMILES | CC[C@@H]1COCCN1c1cc(-c2cc(OC)c3c(N)n[nH]c3c2)nc(N)n1 |
| InChI | InChI=1S/C18H23N7O2/c1-3-11-9-27-5-4-25(11)15-8-12(21-18(20)22-15)10-6-13-16(14(7-10)26-2)17(19)24-23-13/h6-8,11H,3-5,9H2,1-2H3,(H3,19,23,24)(H2,20,21,22)/t11-/m1/s1 |
| InChIKey | VDYIVGTXTWKBGD-LLVKDONJSA-N |
| XLogP | 1.81 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |