C24H29N3O3S — CID 58504905
N-[(2R)-1-(4-methylpiperidin-1-yl)-1-oxo-4-phenylbutan-2-yl]-1H-indole-4-sulfonamide (PubChem CID 58504905) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[(2R)-1-(4-methylpiperidin-1-yl)-1-oxo-4-phenylbutan-2-yl]-1H-indole-4-sulfonamide.
| Compound Name | N-[(2R)-1-(4-methylpiperidin-1-yl)-1-oxo-4-phenylbutan-2-yl]-1H-indole-4-sulfonamide |
|---|---|
| PubChem CID | 58504905 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[(2R)-1-(4-methylpiperidin-1-yl)-1-oxo-4-phenylbutan-2-yl]-1H-indole-4-sulfonamide |
| SMILES | CC1CCN(C(=O)[C@@H](CCc2ccccc2)NS(=O)(=O)c2cccc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C24H29N3O3S/c1-18-13-16-27(17-14-18)24(28)22(11-10-19-6-3-2-4-7-19)26-31(29,30)23-9-5-8-21-20(23)12-15-25-21/h2-9,12,15,18,22,25-26H,10-11,13-14,16-17H2,1H3/t22-/m1/s1 |
| InChIKey | UMBDISMHGNMIII-JOCHJYFZSA-N |
| XLogP | 3.71 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |