C28H35N5O4Si — CID 58506232
ethyl 5-[5-methyl-2-(3-pyridin-4-ylpropanoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate (PubChem CID 58506232) has the molecular formula C28H35N5O4Si and a molecular weight of 533.71 g/mol. Its IUPAC name is ethyl 5-[5-methyl-2-(3-pyridin-4-ylpropanoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate.
| Compound Name | ethyl 5-[5-methyl-2-(3-pyridin-4-ylpropanoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 58506232 |
| Molecular Formula | C28H35N5O4Si |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | ethyl 5-[5-methyl-2-(3-pyridin-4-ylpropanoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(-c3nc(C(=O)CCc4ccncc4)n(COCC[Si](C)(C)C)c3C)cnc2[nH]1 |
| InChI | InChI=1S/C28H35N5O4Si/c1-6-37-28(35)23-16-21-15-22(17-30-26(21)31-23)25-19(2)33(18-36-13-14-38(3,4)5)27(32-25)24(34)8-7-20-9-11-29-12-10-20/h9-12,15-17H,6-8,13-14,18H2,1-5H3,(H,30,31) |
| InChIKey | BZIOQVAUTBRDST-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|