C33H41F3N6O4S — CID 58506293
N-[(3R)-1-(cyclopropylmethyl)piperidin-3-yl]-3-methoxy-4-[[4-[2-[4-methyl-2-[methyl(methylsulfonyl)amino]phenyl]ethyl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide (PubChem CID 58506293) has the molecular formula C33H41F3N6O4S and a molecular weight of 674.79 g/mol. Its IUPAC name is N-[(3R)-1-(cyclopropylmethyl)piperidin-3-yl]-3-methoxy-4-[[4-[2-[4-methyl-2-[methyl(methylsulfonyl)amino]phenyl]ethyl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide.
| Compound Name | N-[(3R)-1-(cyclopropylmethyl)piperidin-3-yl]-3-methoxy-4-[[4-[2-[4-methyl-2-[methyl(methylsulfonyl)amino]phenyl]ethyl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 58506293 |
| Molecular Formula | C33H41F3N6O4S |
| Molecular Weight | 674.79 g/mol |
| Exact Mass | 674.29 |
| IUPAC Name | N-[(3R)-1-(cyclopropylmethyl)piperidin-3-yl]-3-methoxy-4-[[4-[2-[4-methyl-2-[methyl(methylsulfonyl)amino]phenyl]ethyl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide |
| SMILES | COc1cc(C(=O)N[C@@H]2CCCN(CC3CC3)C2)ccc1Nc1ncc(C(F)(F)F)c(CCc2ccc(C)cc2N(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C33H41F3N6O4S/c1-21-7-10-23(29(16-21)41(2)47(4,44)45)11-13-27-26(33(34,35)36)18-37-32(39-27)40-28-14-12-24(17-30(28)46-3)31(43)38-25-6-5-15-42(20-25)19-22-8-9-22/h7,10,12,14,16-18,22,25H,5-6,8-9,11,13,15,19-20H2,1-4H3,(H,38,43)(H,37,39,40)/t25-/m1/s1 |
| InChIKey | XUICTEWYSLVPFR-RUZDIDTESA-N |
| XLogP | 5.34 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.79 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |