C22H31FN2O3 — CID 58507050
(2S,3S)-N-[(4-fluoro-2-octyl-1-benzofuran-5-yl)methyl]-3-hydroxypyrrolidine-2-carboxamide (PubChem CID 58507050) has the molecular formula C22H31FN2O3 and a molecular weight of 390.50 g/mol. Its IUPAC name is (2S,3S)-N-[(4-fluoro-2-octyl-1-benzofuran-5-yl)methyl]-3-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,3S)-N-[(4-fluoro-2-octyl-1-benzofuran-5-yl)methyl]-3-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58507050 |
| Molecular Formula | C22H31FN2O3 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (2S,3S)-N-[(4-fluoro-2-octyl-1-benzofuran-5-yl)methyl]-3-hydroxypyrrolidine-2-carboxamide |
| SMILES | CCCCCCCCc1cc2c(F)c(CNC(=O)[C@H]3NCC[C@@H]3O)ccc2o1 |
| InChI | InChI=1S/C22H31FN2O3/c1-2-3-4-5-6-7-8-16-13-17-19(28-16)10-9-15(20(17)23)14-25-22(27)21-18(26)11-12-24-21/h9-10,13,18,21,24,26H,2-8,11-12,14H2,1H3,(H,25,27)/t18-,21-/m0/s1 |
| InChIKey | SIHIEPCFQIEMBU-RXVVDRJESA-N |
| XLogP | 3.81 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|