C25H18ClF7IN7O2 — CID 58507414
2-[2-[1-(3-chloro-2-pyridinyl)-3-[[4-(1,1,2,2,3,3,3-heptafluoropropyl)triazol-1-yl]methyl]pyrazol-5-yl]-2-oxoethyl]-5-iodo-N,3-dimethylbenzamide (PubChem CID 58507414) has the molecular formula C25H18ClF7IN7O2 and a molecular weight of 743.81 g/mol. Its IUPAC name is 2-[2-[1-(3-chloro-2-pyridinyl)-3-[[4-(1,1,2,2,3,3,3-heptafluoropropyl)triazol-1-yl]methyl]pyrazol-5-yl]-2-oxoethyl]-5-iodo-N,3-dimethylbenzamide.
| Compound Name | 2-[2-[1-(3-chloro-2-pyridinyl)-3-[[4-(1,1,2,2,3,3,3-heptafluoropropyl)triazol-1-yl]methyl]pyrazol-5-yl]-2-oxoethyl]-5-iodo-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 58507414 |
| Molecular Formula | C25H18ClF7IN7O2 |
| Molecular Weight | 743.81 g/mol |
| Exact Mass | 743.01 |
| IUPAC Name | 2-[2-[1-(3-chloro-2-pyridinyl)-3-[[4-(1,1,2,2,3,3,3-heptafluoropropyl)triazol-1-yl]methyl]pyrazol-5-yl]-2-oxoethyl]-5-iodo-N,3-dimethylbenzamide |
| SMILES | CNC(=O)c1cc(I)cc(C)c1CC(=O)c1cc(Cn2cc(C(F)(F)C(F)(F)C(F)(F)F)nn2)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C25H18ClF7IN7O2/c1-12-6-13(34)7-16(22(43)35-2)15(12)9-19(42)18-8-14(38-41(18)21-17(26)4-3-5-36-21)10-40-11-20(37-39-40)23(27,28)24(29,30)25(31,32)33/h3-8,11H,9-10H2,1-2H3,(H,35,43) |
| InChIKey | KPQCDDYZXGFVFM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.81 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|