C24H26O6 — CID 58507570
(3S,3'R,4'S,5'S,6'R)-5-[(4-ethylphenyl)methyl]-6-ethynyl-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 58507570) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-5-[(4-ethylphenyl)methyl]-6-ethynyl-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-5-[(4-ethylphenyl)methyl]-6-ethynyl-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 58507570 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-5-[(4-ethylphenyl)methyl]-6-ethynyl-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | C#Cc1cc2c(cc1Cc1ccc(CC)cc1)[C@]1(OC2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H26O6/c1-3-14-5-7-15(8-6-14)9-17-11-19-18(10-16(17)4-2)13-29-24(19)23(28)22(27)21(26)20(12-25)30-24/h2,5-8,10-11,20-23,25-28H,3,9,12-13H2,1H3/t20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | LXQJVHGIPULTAO-SJSRKZJXSA-N |
| XLogP | 0.98 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|