About 2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile
2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile (PubChem CID 58507666) has the molecular formula C14H27NS
and a molecular weight of 241.44 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile.
Molecular Properties
| Compound Name | 2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile |
| PubChem CID | 58507666 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | 2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile |
| SMILES | CC(C)(C)CCCC(C)(C#N)SC(C)(C)C |
| InChI | InChI=1S/C14H27NS/c1-12(2,3)9-8-10-14(7,11-15)16-13(4,5)6/h8-10H2,1-7H3 |
| InChIKey | RVYHTZPSVIFPLZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile?
The IUPAC name of 2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile (CID 58507666) is 2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile.
What is the SMILES notation for 2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile?
The canonical SMILES for 2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile is CC(C)(C)CCCC(C)(C#N)SC(C)(C)C.
What is the InChIKey of 2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile?
The InChIKey is RVYHTZPSVIFPLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NS/c1-12(2,3)9-8-10-14(7,11-15)16-13(4,5)6/h8-10H2,1-7H3.
What are the key properties of 2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile?
2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile has a molecular weight of 241.44 g/mol, XLogP of 5.02, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylsulfanyl-2,6,6-trimethylheptanenitrile is sourced from PubChem (CID 58507666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).